C19H32N4 — CID 75261424
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-methylmethanamine (PubChem CID 75261424) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-methylmethanamine.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 75261424 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-methylmethanamine |
| SMILES | CN(C)Cc1ccc(CN(C)CC2NNC3CCCCC32)cc1 |
| InChI | InChI=1S/C19H32N4/c1-22(2)12-15-8-10-16(11-9-15)13-23(3)14-19-17-6-4-5-7-18(17)20-21-19/h8-11,17-21H,4-7,12-14H2,1-3H3 |
| InChIKey | MNKTXLFKJWDGBR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |