C33H48BrNO3 — CID 75310973
5-hept-1-enyl-1-heptyl-6,7-dimethoxy-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-2-ium bromide (PubChem CID 75310973) has the molecular formula C33H48BrNO3 and a molecular weight of 586.66 g/mol. Its IUPAC name is 5-hept-1-enyl-1-heptyl-6,7-dimethoxy-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-2-ium bromide.
| Compound Name | 5-hept-1-enyl-1-heptyl-6,7-dimethoxy-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-2-ium bromide |
|---|---|
| PubChem CID | 75310973 |
| Molecular Formula | C33H48BrNO3 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | 5-hept-1-enyl-1-heptyl-6,7-dimethoxy-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-2-ium bromide |
| SMILES | CCCCCC=Cc1c2c(cc(OC)c1OC)C(CCCCCCC)=[N+](Cc1cccc(OC)c1)CC2.[Br-] |
| InChI | InChI=1S/C33H48NO3.BrH/c1-6-8-10-12-14-19-29-28-21-22-34(25-26-17-16-18-27(23-26)35-3)31(20-15-13-11-9-7-2)30(28)24-32(36-4)33(29)37-5;/h14,16-19,23-24H,6-13,15,20-22,25H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | NEBVSBZBKSSJEG-UHFFFAOYSA-M |
| XLogP | 5.23 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|