C9H6Br2F3NO2 — CID 7535357
3,5-dibromo-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 7535357) has the molecular formula C9H6Br2F3NO2 and a molecular weight of 376.95 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 7535357 |
| Molecular Formula | C9H6Br2F3NO2 |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 374.87 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H6Br2F3NO2/c10-4-1-5(7(16)6(11)2-4)8(17)15-3-9(12,13)14/h1-2,16H,3H2,(H,15,17) |
| InChIKey | IJCHZAKISBHHKC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |