C18H28IN3O4 — CID 75364742
N-prop-2-enyl-N'-[(2,3,4-trimethoxyphenyl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 75364742) has the molecular formula C18H28IN3O4 and a molecular weight of 477.34 g/mol. Its IUPAC name is N-prop-2-enyl-N'-[(2,3,4-trimethoxyphenyl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-prop-2-enyl-N'-[(2,3,4-trimethoxyphenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 75364742 |
| Molecular Formula | C18H28IN3O4 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-prop-2-enyl-N'-[(2,3,4-trimethoxyphenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)N1CCOCC1.I |
| InChI | InChI=1S/C18H27N3O4.HI/c1-5-8-19-18(21-9-11-25-12-10-21)20-13-14-6-7-15(22-2)17(24-4)16(14)23-3;/h5-7H,1,8-13H2,2-4H3,(H,19,20);1H |
| InChIKey | JCHDIHFPLRXIER-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|