C18H15N3O2 — CID 75384889
N-(1,3-benzodioxol-5-ylmethyl)-5-phenylpyrimidin-4-amine (PubChem CID 75384889) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-phenylpyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 75384889 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-phenylpyrimidin-4-amine |
| SMILES | c1ccc(-c2cncnc2NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H15N3O2/c1-2-4-14(5-3-1)15-10-19-11-21-18(15)20-9-13-6-7-16-17(8-13)23-12-22-16/h1-8,10-11H,9,12H2,(H,19,20,21) |
| InChIKey | MPPCQPFDZNNHSJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |