C16H21FN2O3S — CID 75408342
(E)-4-(2-fluorophenyl)-N-(1-methylsulfonylpiperidin-3-yl)but-3-enamide (PubChem CID 75408342) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is (E)-4-(2-fluorophenyl)-N-(1-methylsulfonylpiperidin-3-yl)but-3-enamide.
| Compound Name | (E)-4-(2-fluorophenyl)-N-(1-methylsulfonylpiperidin-3-yl)but-3-enamide |
|---|---|
| PubChem CID | 75408342 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (E)-4-(2-fluorophenyl)-N-(1-methylsulfonylpiperidin-3-yl)but-3-enamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)C/C=C/c2ccccc2F)C1 |
| InChI | InChI=1S/C16H21FN2O3S/c1-23(21,22)19-11-5-8-14(12-19)18-16(20)10-4-7-13-6-2-3-9-15(13)17/h2-4,6-7,9,14H,5,8,10-12H2,1H3,(H,18,20)/b7-4+ |
| InChIKey | DJQJRUQLOKODRL-QPJJXVBHSA-N |
| XLogP | 1.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |