C28H31N5O5S — CID 75408648
[4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 75408648) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 75408648 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Oc2ccc(/C=C(/C#N)c3nnc4n3CCCCC4)cc2OC)cc1 |
| InChI | InChI=1S/C28H31N5O5S/c1-4-32(5-2)39(35,36)23-13-11-21(12-14-23)28(34)38-24-15-10-20(18-25(24)37-3)17-22(19-29)27-31-30-26-9-7-6-8-16-33(26)27/h10-15,17-18H,4-9,16H2,1-3H3/b22-17- |
| InChIKey | OHXNWSNXKXZVNL-XLNRJJMWSA-N |
| XLogP | 4.33 |
| TPSA | 127.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|