C18H18F2N4O2 — CID 51167037
(Z)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 51167037) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 51167037 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nnc3n2CCCCC3)ccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N4O2/c1-25-15-10-12(6-7-14(15)26-18(19)20)9-13(11-21)17-23-22-16-5-3-2-4-8-24(16)17/h6-7,9-10,18H,2-5,8H2,1H3/b13-9- |
| InChIKey | LCXOMMGSIKUVPX-LCYFTJDESA-N |
| XLogP | 3.68 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|