C24H21IN4O3 — CID 75408580
[4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-iodobenzoate (PubChem CID 75408580) has the molecular formula C24H21IN4O3 and a molecular weight of 540.36 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-iodobenzoate.
| Compound Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 75408580 |
| Molecular Formula | C24H21IN4O3 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-iodobenzoate |
| SMILES | COc1cc(/C=C(/C#N)c2nnc3n2CCCCC3)ccc1OC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C24H21IN4O3/c1-31-21-14-16(6-11-20(21)32-24(30)17-7-9-19(25)10-8-17)13-18(15-26)23-28-27-22-5-3-2-4-12-29(22)23/h6-11,13-14H,2-5,12H2,1H3/b18-13- |
| InChIKey | XWBOTXZBVYDZKG-AQTBWJFISA-N |
| XLogP | 4.90 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|