C24H22N4O4 — CID 3657415
[4-[2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 3657415) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is [4-[2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3657415 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [4-[2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | COc1cc(C=C(C#N)c2nnc3n2CCCCC3)ccc1OC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C24H22N4O4/c1-30-21-15-17(8-10-20(21)32-23(29)11-9-19-6-5-13-31-19)14-18(16-25)24-27-26-22-7-3-2-4-12-28(22)24/h5-6,8-11,13-15H,2-4,7,12H2,1H3 |
| InChIKey | LYISEPOQWIIVHO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|