C28H29N5O6S — CID 75408647
[4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 75408647) has the molecular formula C28H29N5O6S and a molecular weight of 563.64 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 75408647 |
| Molecular Formula | C28H29N5O6S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | [4-[(Z)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]-2-methoxyphenyl] 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1cc(/C=C(/C#N)c2nnc3n2CCCCC3)ccc1OC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H29N5O6S/c1-37-25-18-20(17-22(19-29)27-31-30-26-5-3-2-4-12-33(26)27)6-11-24(25)39-28(34)21-7-9-23(10-8-21)40(35,36)32-13-15-38-16-14-32/h6-11,17-18H,2-5,12-16H2,1H3/b22-17- |
| InChIKey | JEAXIHWVBYUART-XLNRJJMWSA-N |
| XLogP | 3.32 |
| TPSA | 136.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|