C18H13N3O3 — CID 75416558
4-[4-(1,3-oxazol-5-yl)benzoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 75416558) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[4-(1,3-oxazol-5-yl)benzoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[4-(1,3-oxazol-5-yl)benzoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 75416558 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-[4-(1,3-oxazol-5-yl)benzoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(-c3cnco3)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C18H13N3O3/c22-17-10-21(15-4-2-1-3-14(15)20-17)18(23)13-7-5-12(6-8-13)16-9-19-11-24-16/h1-9,11H,10H2,(H,20,22) |
| InChIKey | ANQCXBTWHILCGU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |