C17H19FN2O4S2 — CID 75417123
4-(3-fluorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]oxane-4-carboxamide (PubChem CID 75417123) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 75417123 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]oxane-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C2(c3cccc(F)c3)CCOCC2)s1 |
| InChI | InChI=1S/C17H19FN2O4S2/c18-13-3-1-2-12(10-13)17(6-8-24-9-7-17)16(21)20-11-14-4-5-15(25-14)26(19,22)23/h1-5,10H,6-9,11H2,(H,20,21)(H2,19,22,23) |
| InChIKey | FYDKWKZWKMJJBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |