C12H13ClN4OS — CID 75450465
N'-[(5-chloro-2-pyridinyl)methoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide (PubChem CID 75450465) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is N'-[(5-chloro-2-pyridinyl)methoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide.
| Compound Name | N'-[(5-chloro-2-pyridinyl)methoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 75450465 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N'-[(5-chloro-2-pyridinyl)methoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
| SMILES | Cc1csc(C/C(N)=N/OCc2ccc(Cl)cn2)n1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-8-7-19-12(16-8)4-11(14)17-18-6-10-3-2-9(13)5-15-10/h2-3,5,7H,4,6H2,1H3,(H2,14,17) |
| InChIKey | DMHMEKJFLZMWHL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|