C6H10N4S — CID 62795006
N'-amino-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide (PubChem CID 62795006) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is N'-amino-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide.
| Compound Name | N'-amino-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 62795006 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | N'-amino-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
| SMILES | Cc1csc(C/C(N)=N/N)n1 |
| InChI | InChI=1S/C6H10N4S/c1-4-3-11-6(9-4)2-5(7)10-8/h3H,2,8H2,1H3,(H2,7,10) |
| InChIKey | SNFKTTHUTYQLSG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|