C17H17FN6O5 — CID 75452210
methyl 2-[[[3-[(4-fluorophenyl)methylcarbamoyl]pyrazine-2-carbonyl]amino]carbamoylamino]acetate (PubChem CID 75452210) has the molecular formula C17H17FN6O5 and a molecular weight of 404.36 g/mol. Its IUPAC name is methyl 2-[[[3-[(4-fluorophenyl)methylcarbamoyl]pyrazine-2-carbonyl]amino]carbamoylamino]acetate.
| Compound Name | methyl 2-[[[3-[(4-fluorophenyl)methylcarbamoyl]pyrazine-2-carbonyl]amino]carbamoylamino]acetate |
|---|---|
| PubChem CID | 75452210 |
| Molecular Formula | C17H17FN6O5 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 2-[[[3-[(4-fluorophenyl)methylcarbamoyl]pyrazine-2-carbonyl]amino]carbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)NNC(=O)c1nccnc1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN6O5/c1-29-12(25)9-22-17(28)24-23-16(27)14-13(19-6-7-20-14)15(26)21-8-10-2-4-11(18)5-3-10/h2-7H,8-9H2,1H3,(H,21,26)(H,23,27)(H2,22,24,28) |
| InChIKey | VNPOEDGIWFODJH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 151.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|