C21H34ClN3O — CID 75454258
1-(3-chlorophenyl)-4-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 75454258) has the molecular formula C21H34ClN3O and a molecular weight of 379.98 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-4-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 75454258 |
| Molecular Formula | C21H34ClN3O |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CN(C)CCN1CCC(NC2CCC(O)(c3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C21H34ClN3O/c1-24(2)14-15-25-12-8-20(9-13-25)23-19-6-10-21(26,11-7-19)17-4-3-5-18(22)16-17/h3-5,16,19-20,23,26H,6-15H2,1-2H3 |
| InChIKey | GLNAQPDDRQKMTH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |