C13H19NOS — CID 75457077
(1R,2S)-1-(2-ethylsulfanylethylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 75457077) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is (1R,2S)-1-(2-ethylsulfanylethylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-(2-ethylsulfanylethylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 75457077 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (1R,2S)-1-(2-ethylsulfanylethylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | CCSCCN[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C13H19NOS/c1-2-16-8-7-14-13-11-6-4-3-5-10(11)9-12(13)15/h3-6,12-15H,2,7-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | PHODMYUKQXJBJV-QWHCGFSZSA-N |
| XLogP | 1.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|