C19H20FN5O2 — CID 75468904
5-(4-fluorophenyl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2-oxazole-3-carboxamide (PubChem CID 75468904) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 75468904 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)c1nnc2n1CC(NC(=O)c1cc(-c3ccc(F)cc3)on1)CC2 |
| InChI | InChI=1S/C19H20FN5O2/c1-11(2)18-23-22-17-8-7-14(10-25(17)18)21-19(26)15-9-16(27-24-15)12-3-5-13(20)6-4-12/h3-6,9,11,14H,7-8,10H2,1-2H3,(H,21,26) |
| InChIKey | OEGPWSKQMJYDDP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |