C15H28N4O — CID 75482102
2-[[(cyclohexylamino)-pyrrolidin-1-ylmethylidene]amino]-N,N-dimethylacetamide (PubChem CID 75482102) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-pyrrolidin-1-ylmethylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-pyrrolidin-1-ylmethylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 75482102 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-[[(cyclohexylamino)-pyrrolidin-1-ylmethylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C15H28N4O/c1-18(2)14(20)12-16-15(19-10-6-7-11-19)17-13-8-4-3-5-9-13/h13H,3-12H2,1-2H3,(H,16,17) |
| InChIKey | GQDWWWRALSOOSM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|