C14H21N3O — CID 75485051
3-(4,6-dimethyl-2-pyridinyl)-1-ethyl-1-(2-methylprop-2-enyl)urea (PubChem CID 75485051) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-pyridinyl)-1-ethyl-1-(2-methylprop-2-enyl)urea.
| Compound Name | 3-(4,6-dimethyl-2-pyridinyl)-1-ethyl-1-(2-methylprop-2-enyl)urea |
|---|---|
| PubChem CID | 75485051 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(4,6-dimethyl-2-pyridinyl)-1-ethyl-1-(2-methylprop-2-enyl)urea |
| SMILES | C=C(C)CN(CC)C(=O)Nc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C14H21N3O/c1-6-17(9-10(2)3)14(18)16-13-8-11(4)7-12(5)15-13/h7-8H,2,6,9H2,1,3-5H3,(H,15,16,18) |
| InChIKey | CHKYMEFXUZASQJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|