C22H41N6O7P — CID 75490935
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;tributylazanium (PubChem CID 75490935) has the molecular formula C22H41N6O7P and a molecular weight of 532.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;tributylazanium.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;tributylazanium |
|---|---|
| PubChem CID | 75490935 |
| Molecular Formula | C22H41N6O7P |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;tributylazanium |
| SMILES | CCCC[NH+](CCCC)CCCC.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H27N.C10H14N5O7P/c1-4-7-10-13(11-8-5-2)12-9-6-3;11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h4-12H2,1-3H3;2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t;4-,6-,7-,10-/m.1/s1 |
| InChIKey | HMQXMCHJEYYQGM-LPEHXXKESA-N |
| XLogP | -0.22 |
| TPSA | 193.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|