C15H12F2N2O5 — CID 75503023
methyl 1-[2-(2,3-difluorophenyl)ethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 75503023) has the molecular formula C15H12F2N2O5 and a molecular weight of 338.27 g/mol. Its IUPAC name is methyl 1-[2-(2,3-difluorophenyl)ethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-(2,3-difluorophenyl)ethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 75503023 |
| Molecular Formula | C15H12F2N2O5 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 1-[2-(2,3-difluorophenyl)ethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CCc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C15H12F2N2O5/c1-24-15(21)10-7-12(19(22)23)14(20)18(8-10)6-5-9-3-2-4-11(16)13(9)17/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | JTCVAOSQYSNSLU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|