C13H16N6O — CID 75512496
2-pyrrolidin-1-yl-N-(2H-triazol-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 75512496) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-N-(2H-triazol-4-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-pyrrolidin-1-yl-N-(2H-triazol-4-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75512496 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-pyrrolidin-1-yl-N-(2H-triazol-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cn[nH]n1)c1cccnc1N1CCCC1 |
| InChI | InChI=1S/C13H16N6O/c20-13(15-8-10-9-16-18-17-10)11-4-3-5-14-12(11)19-6-1-2-7-19/h3-5,9H,1-2,6-8H2,(H,15,20)(H,16,17,18) |
| InChIKey | LGCDKDWOBQVJSH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |