C25H31N3O2+2 — CID 7551955
(E)-1-(4-ethoxyphenyl)-3-[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]prop-2-en-1-one (PubChem CID 7551955) has the molecular formula C25H31N3O2+2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (E)-1-(4-ethoxyphenyl)-3-[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethoxyphenyl)-3-[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 7551955 |
| Molecular Formula | C25H31N3O2+2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (E)-1-(4-ethoxyphenyl)-3-[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)/C=C/c2cn(C[NH+]3CC[NH+](C)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H29N3O2/c1-3-30-22-11-8-20(9-12-22)25(29)13-10-21-18-28(24-7-5-4-6-23(21)24)19-27-16-14-26(2)15-17-27/h4-13,18H,3,14-17,19H2,1-2H3/p+2/b13-10+ |
| InChIKey | JUXHLKQLGSQYON-JLHYYAGUSA-P |
| XLogP | 1.31 |
| TPSA | 40.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|