About (2-cyano-2-methylpropyl) 4-acetylbenzoate
(2-cyano-2-methylpropyl) 4-acetylbenzoate (PubChem CID 75520103) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is (2-cyano-2-methylpropyl) 4-acetylbenzoate.
Molecular Properties
| Compound Name | (2-cyano-2-methylpropyl) 4-acetylbenzoate |
| PubChem CID | 75520103 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (2-cyano-2-methylpropyl) 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C14H15NO3/c1-10(16)11-4-6-12(7-5-11)13(17)18-9-14(2,3)8-15/h4-7H,9H2,1-3H3 |
| InChIKey | FJGFHGKHTHOJDM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyano-2-methylpropyl) 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-2-methylpropyl) 4-acetylbenzoate?
The IUPAC name of (2-cyano-2-methylpropyl) 4-acetylbenzoate (CID 75520103) is (2-cyano-2-methylpropyl) 4-acetylbenzoate.
What is the SMILES notation for (2-cyano-2-methylpropyl) 4-acetylbenzoate?
The canonical SMILES for (2-cyano-2-methylpropyl) 4-acetylbenzoate is CC(=O)c1ccc(C(=O)OCC(C)(C)C#N)cc1.
What is the InChIKey of (2-cyano-2-methylpropyl) 4-acetylbenzoate?
The InChIKey is FJGFHGKHTHOJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-10(16)11-4-6-12(7-5-11)13(17)18-9-14(2,3)8-15/h4-7H,9H2,1-3H3.
What are the key properties of (2-cyano-2-methylpropyl) 4-acetylbenzoate?
(2-cyano-2-methylpropyl) 4-acetylbenzoate has a molecular weight of 245.28 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-2-methylpropyl) 4-acetylbenzoate is sourced from PubChem (CID 75520103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).