C18H27N5 — CID 75521521
N-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(1-phenyltriazol-4-yl)propan-2-amine (PubChem CID 75521521) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(1-phenyltriazol-4-yl)propan-2-amine.
| Compound Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(1-phenyltriazol-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 75521521 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-2-(1-phenyltriazol-4-yl)propan-2-amine |
| SMILES | CN1CCCC1CCNC(C)(C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C18H27N5/c1-18(2,19-12-11-15-10-7-13-22(15)3)17-14-23(21-20-17)16-8-5-4-6-9-16/h4-6,8-9,14-15,19H,7,10-13H2,1-3H3 |
| InChIKey | HRYSLPKQVCGKAC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |