C22H23N2OS+ — CID 7552640
3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]thiochromen-4-one (PubChem CID 7552640) has the molecular formula C22H23N2OS+ and a molecular weight of 363.51 g/mol. Its IUPAC name is 3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]thiochromen-4-one.
| Compound Name | 3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]thiochromen-4-one |
|---|---|
| PubChem CID | 7552640 |
| Molecular Formula | C22H23N2OS+ |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]thiochromen-4-one |
| SMILES | O=c1c(N2CC[NH+](C/C=C/c3ccccc3)CC2)csc2ccccc12 |
| InChI | InChI=1S/C22H22N2OS/c25-22-19-10-4-5-11-21(19)26-17-20(22)24-15-13-23(14-16-24)12-6-9-18-7-2-1-3-8-18/h1-11,17H,12-16H2/p+1/b9-6+ |
| InChIKey | ZOKGRJDIYQSZIT-RMKNXTFCSA-O |
| XLogP | 2.68 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |