C23H24N2OS — CID 7552686
6-methyl-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]thiochromen-4-one (PubChem CID 7552686) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-methyl-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]thiochromen-4-one.
| Compound Name | 6-methyl-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]thiochromen-4-one |
|---|---|
| PubChem CID | 7552686 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 6-methyl-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]thiochromen-4-one |
| SMILES | Cc1ccc2scc(N3CCN(C/C=C/c4ccccc4)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C23H24N2OS/c1-18-9-10-22-20(16-18)23(26)21(17-27-22)25-14-12-24(13-15-25)11-5-8-19-6-3-2-4-7-19/h2-10,16-17H,11-15H2,1H3/b8-5+ |
| InChIKey | AZKWOKVOMVQLOB-VMPITWQZSA-N |
| XLogP | 4.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |