C11H15BrN2O2S — CID 75534700
N-[2-(6-bromo-2,3-dihydroindol-1-yl)ethyl]methanesulfonamide (PubChem CID 75534700) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is N-[2-(6-bromo-2,3-dihydroindol-1-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(6-bromo-2,3-dihydroindol-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 75534700 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | N-[2-(6-bromo-2,3-dihydroindol-1-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-17(15,16)13-5-7-14-6-4-9-2-3-10(12)8-11(9)14/h2-3,8,13H,4-7H2,1H3 |
| InChIKey | VLQSKVISHDUMDH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |