C24H15N3O4 — CID 7554879
(13S)-14-(5-methyl-1,2-oxazol-3-yl)-13-pyridin-2-yl-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 7554879) has the molecular formula C24H15N3O4 and a molecular weight of 409.40 g/mol. Its IUPAC name is (13S)-14-(5-methyl-1,2-oxazol-3-yl)-13-pyridin-2-yl-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | (13S)-14-(5-methyl-1,2-oxazol-3-yl)-13-pyridin-2-yl-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 7554879 |
| Molecular Formula | C24H15N3O4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (13S)-14-(5-methyl-1,2-oxazol-3-yl)-13-pyridin-2-yl-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | Cc1cc(N2C(=O)c3oc4c(ccc5ccccc54)c(=O)c3[C@H]2c2ccccn2)no1 |
| InChI | InChI=1S/C24H15N3O4/c1-13-12-18(26-31-13)27-20(17-8-4-5-11-25-17)19-21(28)16-10-9-14-6-2-3-7-15(14)22(16)30-23(19)24(27)29/h2-12,20H,1H3/t20-/m1/s1 |
| InChIKey | XNVIXCOFPZHQBP-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|