C14H25ClN5O5+ — CID 75608952
7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride (PubChem CID 75608952) has the molecular formula C14H25ClN5O5+ and a molecular weight of 378.84 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride.
| Compound Name | 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 75608952 |
| Molecular Formula | C14H25ClN5O5+ |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
| SMILES | COCC1=[N+](CC(O)CNCCO)C2C(=O)N(C)C(=O)N(C)C2=N1.Cl |
| InChI | InChI=1S/C14H24N5O5.ClH/c1-17-12-11(13(22)18(2)14(17)23)19(10(16-12)8-24-3)7-9(21)6-15-4-5-20;/h9,11,15,20-21H,4-8H2,1-3H3;1H/q+1; |
| InChIKey | JIJDKSSZITYPMM-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|