C12H21ClN5O2+ — CID 75609004
7-(2-aminoethyl)-1,3-dimethyl-8-propyl-5H-purin-7-ium-2,6-dione;hydrochloride (PubChem CID 75609004) has the molecular formula C12H21ClN5O2+ and a molecular weight of 302.79 g/mol. Its IUPAC name is 7-(2-aminoethyl)-1,3-dimethyl-8-propyl-5H-purin-7-ium-2,6-dione;hydrochloride.
| Compound Name | 7-(2-aminoethyl)-1,3-dimethyl-8-propyl-5H-purin-7-ium-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 75609004 |
| Molecular Formula | C12H21ClN5O2+ |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 7-(2-aminoethyl)-1,3-dimethyl-8-propyl-5H-purin-7-ium-2,6-dione;hydrochloride |
| SMILES | CCCC1=[N+](CCN)C2C(=O)N(C)C(=O)N(C)C2=N1.Cl |
| InChI | InChI=1S/C12H20N5O2.ClH/c1-4-5-8-14-10-9(17(8)7-6-13)11(18)16(3)12(19)15(10)2;/h9H,4-7,13H2,1-3H3;1H/q+1; |
| InChIKey | QHLGMBMYRJASLR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|