C8H10N4O3 — CID 75634729
1,3,7-trimethyl-5H-purine-2,6,8-trione (PubChem CID 75634729) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1,3,7-trimethyl-5H-purine-2,6,8-trione.
| Compound Name | 1,3,7-trimethyl-5H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 75634729 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1,3,7-trimethyl-5H-purine-2,6,8-trione |
| SMILES | CN1C(=O)C2C(=NC(=O)N2C)N(C)C1=O |
| InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h4H,1-3H3 |
| InChIKey | BMPZJVFJRYVRJD-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |