C16H32N2O4+2 — CID 7590532
(2R)-1-[4-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]piperazine-1,4-diium-1-yl]-3-prop-2-enoxypropan-2-ol (PubChem CID 7590532) has the molecular formula C16H32N2O4+2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R)-1-[4-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]piperazine-1,4-diium-1-yl]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[4-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]piperazine-1,4-diium-1-yl]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 7590532 |
| Molecular Formula | C16H32N2O4+2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2R)-1-[4-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]piperazine-1,4-diium-1-yl]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)C[NH+]1CC[NH+](C[C@@H](O)COCC=C)CC1 |
| InChI | InChI=1S/C16H30N2O4/c1-3-9-21-13-15(19)11-17-5-7-18(8-6-17)12-16(20)14-22-10-4-2/h3-4,15-16,19-20H,1-2,5-14H2/p+2/t15-,16+ |
| InChIKey | CANOSVFVDJPTQZ-IYBDPMFKSA-P |
| XLogP | -3.10 |
| TPSA | 67.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|