C14H18Cl2N3O3+ — CID 7591846
(2S)-4-(2,5-dichloroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate (PubChem CID 7591846) has the molecular formula C14H18Cl2N3O3+ and a molecular weight of 347.22 g/mol. Its IUPAC name is (2S)-4-(2,5-dichloroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate.
| Compound Name | (2S)-4-(2,5-dichloroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate |
|---|---|
| PubChem CID | 7591846 |
| Molecular Formula | C14H18Cl2N3O3+ |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (2S)-4-(2,5-dichloroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate |
| SMILES | O=C(C[C@@H](C(=O)[O-])[NH+]1CC[NH2+]CC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O3/c15-9-1-2-10(16)11(7-9)18-13(20)8-12(14(21)22)19-5-3-17-4-6-19/h1-2,7,12,17H,3-6,8H2,(H,18,20)(H,21,22)/p+1/t12-/m0/s1 |
| InChIKey | CFATZDUUAUFCJW-LBPRGKRZSA-O |
| XLogP | -2.10 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |