C14H19FN3O3+ — CID 7592504
(2R)-4-(3-fluoroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate (PubChem CID 7592504) has the molecular formula C14H19FN3O3+ and a molecular weight of 296.32 g/mol. Its IUPAC name is (2R)-4-(3-fluoroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate.
| Compound Name | (2R)-4-(3-fluoroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate |
|---|---|
| PubChem CID | 7592504 |
| Molecular Formula | C14H19FN3O3+ |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2R)-4-(3-fluoroanilino)-4-oxo-2-piperazine-1,4-diium-1-ylbutanoate |
| SMILES | O=C(C[C@H](C(=O)[O-])[NH+]1CC[NH2+]CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H18FN3O3/c15-10-2-1-3-11(8-10)17-13(19)9-12(14(20)21)18-6-4-16-5-7-18/h1-3,8,12,16H,4-7,9H2,(H,17,19)(H,20,21)/p+1/t12-/m1/s1 |
| InChIKey | TXYGTYBQBXNEGR-GFCCVEGCSA-O |
| XLogP | -3.27 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |