C14H14F3N3O2S2 — CID 75975226
5-pyrazolidin-3-yl-N-[3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 75975226) has the molecular formula C14H14F3N3O2S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 5-pyrazolidin-3-yl-N-[3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-pyrazolidin-3-yl-N-[3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 75975226 |
| Molecular Formula | C14H14F3N3O2S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-pyrazolidin-3-yl-N-[3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C(F)(F)F)c1)c1ccc(C2CCNN2)s1 |
| InChI | InChI=1S/C14H14F3N3O2S2/c15-14(16,17)9-2-1-3-10(8-9)20-24(21,22)13-5-4-12(23-13)11-6-7-18-19-11/h1-5,8,11,18-20H,6-7H2 |
| InChIKey | WECDJZPBHJTLOR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |