C16H15F2N5O2 — CID 7599499
2-butyl-9-(2,6-difluorophenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 7599499) has the molecular formula C16H15F2N5O2 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-butyl-9-(2,6-difluorophenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-butyl-9-(2,6-difluorophenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7599499 |
| Molecular Formula | C16H15F2N5O2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-butyl-9-(2,6-difluorophenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCCCc1nc(C(N)=O)c2[nH]c(=O)n(-c3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C16H15F2N5O2/c1-2-3-7-10-20-11(14(19)24)12-15(21-10)23(16(25)22-12)13-8(17)5-4-6-9(13)18/h4-6H,2-3,7H2,1H3,(H2,19,24)(H,22,25) |
| InChIKey | USXIXUGTONLCEF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |