C14H14N6O3S — CID 7617558
[(1S)-1-cyanoethyl] 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate (PubChem CID 7617558) has the molecular formula C14H14N6O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | [(1S)-1-cyanoethyl] 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7617558 |
| Molecular Formula | C14H14N6O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(1S)-1-cyanoethyl] 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
| SMILES | C[C@@H](C#N)OC(=O)c1ccc(NC(=O)CSc2nnnn2C)cc1 |
| InChI | InChI=1S/C14H14N6O3S/c1-9(7-15)23-13(22)10-3-5-11(6-4-10)16-12(21)8-24-14-17-18-19-20(14)2/h3-6,9H,8H2,1-2H3,(H,16,21)/t9-/m0/s1 |
| InChIKey | XGJOKVGFJHAKLF-VIFPVBQESA-N |
| XLogP | 1.01 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |