C18H19BrFNO4 — CID 7635085
(4-bromo-2-fluorophenyl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 7635085) has the molecular formula C18H19BrFNO4 and a molecular weight of 412.26 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7635085 |
| Molecular Formula | C18H19BrFNO4 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H19BrFNO4/c19-12-6-5-11(15(20)9-12)10-25-16(22)7-8-21-17(23)13-3-1-2-4-14(13)18(21)24/h5-6,9,13-14H,1-4,7-8,10H2/t13-,14-/m1/s1 |
| InChIKey | XFZVIKPLRFIEMV-ZIAGYGMSSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|