C13H13BrFNO3S — CID 55442899
(4-bromo-2-fluorophenyl)methyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55442899) has the molecular formula C13H13BrFNO3S and a molecular weight of 362.22 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55442899 |
| Molecular Formula | C13H13BrFNO3S |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | O=C(CCN1CCSC1=O)OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H13BrFNO3S/c14-10-2-1-9(11(15)7-10)8-19-12(17)3-4-16-5-6-20-13(16)18/h1-2,7H,3-6,8H2 |
| InChIKey | PPCUHVFRODNHDY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|