C20H28O3 — CID 76518516
4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 76518516) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 76518516 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1=C(CCc2ccoc2)C2(C)CCC(O)C(C)(C)C2CC1=O |
| InChI | InChI=1S/C20H28O3/c1-13-15(6-5-14-8-10-23-12-14)20(4)9-7-18(22)19(2,3)17(20)11-16(13)21/h8,10,12,17-18,22H,5-7,9,11H2,1-4H3 |
| InChIKey | FSTZHPYSBDCPKR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |