C15H24N2O4+2 — CID 7658028
3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]azaniumyl]propyl-dimethylazanium (PubChem CID 7658028) has the molecular formula C15H24N2O4+2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]azaniumyl]propyl-dimethylazanium.
| Compound Name | 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]azaniumyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7658028 |
| Molecular Formula | C15H24N2O4+2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]azaniumyl]propyl-dimethylazanium |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2[NH2+]CCC[NH+](C)C |
| InChI | InChI=1S/C15H22N2O4/c1-17(2)9-5-8-16-14-10-6-7-11(19-3)13(20-4)12(10)15(18)21-14/h6-7,14,16H,5,8-9H2,1-4H3/p+2/t14-/m0/s1 |
| InChIKey | CYONXCWAEQTJIM-AWEZNQCLSA-P |
| XLogP | -1.03 |
| TPSA | 65.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|