C29H34BFO5 — CID 76584666
2-[4-[2,3-bis(phenylmethoxy)propoxy]-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 76584666) has the molecular formula C29H34BFO5 and a molecular weight of 492.40 g/mol. Its IUPAC name is 2-[4-[2,3-bis(phenylmethoxy)propoxy]-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2,3-bis(phenylmethoxy)propoxy]-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 76584666 |
| Molecular Formula | C29H34BFO5 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[4-[2,3-bis(phenylmethoxy)propoxy]-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OCC(COCc3ccccc3)OCc3ccccc3)cc2F)OC1(C)C |
| InChI | InChI=1S/C29H34BFO5/c1-28(2)29(3,4)36-30(35-28)26-16-15-24(17-27(26)31)34-21-25(33-19-23-13-9-6-10-14-23)20-32-18-22-11-7-5-8-12-22/h5-17,25H,18-21H2,1-4H3 |
| InChIKey | OUJLNLOTKGMHMH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|