C26H35BFNO5 — CID 66635888
tert-butyl N-[(2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-yl]carbamate (PubChem CID 66635888) has the molecular formula C26H35BFNO5 and a molecular weight of 471.38 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 66635888 |
| Molecular Formula | C26H35BFNO5 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | tert-butyl N-[(2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C26H35BFNO5/c1-24(2,3)32-23(30)29-19(15-18-11-9-8-10-12-18)17-31-20-13-14-21(22(28)16-20)27-33-25(4,5)26(6,7)34-27/h8-14,16,19H,15,17H2,1-7H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | FSUNKJRRFFMMOE-LJQANCHMSA-N |
| XLogP | 4.64 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|