C14H21N2O2+ — CID 7659355
2-cyanopropan-2-yl-[2-(3,4-dimethoxyphenyl)ethyl]azanium (PubChem CID 7659355) has the molecular formula C14H21N2O2+ and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-cyanopropan-2-yl-[2-(3,4-dimethoxyphenyl)ethyl]azanium.
| Compound Name | 2-cyanopropan-2-yl-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7659355 |
| Molecular Formula | C14H21N2O2+ |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-cyanopropan-2-yl-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc(CC[NH2+]C(C)(C)C#N)cc1OC |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,10-15)16-8-7-11-5-6-12(17-3)13(9-11)18-4/h5-6,9,16H,7-8H2,1-4H3/p+1 |
| InChIKey | MRLUSDSLJWTUOJ-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |