C20H32F2O5 — CID 76594967
4-[3,3-difluoro-4-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 76594967) has the molecular formula C20H32F2O5 and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[3,3-difluoro-4-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | 4-[3,3-difluoro-4-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 76594967 |
| Molecular Formula | C20H32F2O5 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-[3,3-difluoro-4-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCCC(OC1CCCCO1)C(F)(F)C=CC1C(O)CC2OC(O)CC21 |
| InChI | InChI=1S/C20H32F2O5/c1-2-3-6-17(27-19-7-4-5-10-25-19)20(21,22)9-8-13-14-11-18(24)26-16(14)12-15(13)23/h8-9,13-19,23-24H,2-7,10-12H2,1H3 |
| InChIKey | NFVALXRCFIZGPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|