C34H39N4O+ — CID 76712470
N-(2-aminoethyl)-4-[1-(1,3,3-trimethylindol-1-ium-2-yl)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-en-2-yl]benzamide (PubChem CID 76712470) has the molecular formula C34H39N4O+ and a molecular weight of 519.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[1-(1,3,3-trimethylindol-1-ium-2-yl)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-en-2-yl]benzamide.
| Compound Name | N-(2-aminoethyl)-4-[1-(1,3,3-trimethylindol-1-ium-2-yl)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 76712470 |
| Molecular Formula | C34H39N4O+ |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | N-(2-aminoethyl)-4-[1-(1,3,3-trimethylindol-1-ium-2-yl)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-en-2-yl]benzamide |
| SMILES | CN1C(=CC(=CC2=[N+](C)c3ccccc3C2(C)C)c2ccc(C(=O)NCCN)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H38N4O/c1-33(2)26-11-7-9-13-28(26)37(5)30(33)21-25(23-15-17-24(18-16-23)32(39)36-20-19-35)22-31-34(3,4)27-12-8-10-14-29(27)38(31)6/h7-18,21-22H,19-20,35H2,1-6H3/p+1 |
| InChIKey | ZJEOTUJUHHFKLX-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|