C38H45N4O6S+ — CID 76712469
1-(6-hydrazinyl-6-oxohexyl)-2-[2-(4-methoxycarbonylphenyl)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 76712469) has the molecular formula C38H45N4O6S+ and a molecular weight of 685.87 g/mol. Its IUPAC name is 1-(6-hydrazinyl-6-oxohexyl)-2-[2-(4-methoxycarbonylphenyl)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | 1-(6-hydrazinyl-6-oxohexyl)-2-[2-(4-methoxycarbonylphenyl)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 76712469 |
| Molecular Formula | C38H45N4O6S+ |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 1-(6-hydrazinyl-6-oxohexyl)-2-[2-(4-methoxycarbonylphenyl)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | COC(=O)c1ccc(C(=CC2=[N+](C)c3ccccc3C2(C)C)C=C2N(CCCCCC(=O)NN)c3ccc(S(=O)(=O)O)cc3C2(C)C)cc1 |
| InChI | InChI=1S/C38H44N4O6S/c1-37(2)29-12-9-10-13-31(29)41(5)33(37)22-27(25-15-17-26(18-16-25)36(44)48-6)23-34-38(3,4)30-24-28(49(45,46)47)19-20-32(30)42(34)21-11-7-8-14-35(43)40-39/h9-10,12-13,15-20,22-24,39H,7-8,11,14,21H2,1-6H3,(H2,44,45,46,47)/p+1 |
| InChIKey | DHLVVJIPGCFWJL-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|